C22H18ClN3O5S — CID 38487232
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-6-methoxy-1H-indole-2-carboxamide (PubChem CID 38487232) has the molecular formula C22H18ClN3O5S and a molecular weight of 471.92 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-6-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-6-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 38487232 |
| Molecular Formula | C22H18ClN3O5S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-6-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2cc(C(=O)Nc3cc(S(=O)(=O)Nc4cccc(Cl)c4)ccc3O)[nH]c2c1 |
| InChI | InChI=1S/C22H18ClN3O5S/c1-31-16-6-5-13-9-20(24-18(13)11-16)22(28)25-19-12-17(7-8-21(19)27)32(29,30)26-15-4-2-3-14(23)10-15/h2-12,24,26-27H,1H3,(H,25,28) |
| InChIKey | CPFCCQSELYEYHW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|