C22H22ClN3O6S — CID 36927097
methyl 5-[[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate (PubChem CID 36927097) has the molecular formula C22H22ClN3O6S and a molecular weight of 491.95 g/mol. Its IUPAC name is methyl 5-[[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 36927097 |
| Molecular Formula | C22H22ClN3O6S |
| Molecular Weight | 491.95 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | methyl 5-[[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCc1[nH]c(C(=O)Nc2cc(S(=O)(=O)Nc3cccc(Cl)c3)ccc2O)c(C)c1C(=O)OC |
| InChI | InChI=1S/C22H22ClN3O6S/c1-4-16-19(22(29)32-3)12(2)20(24-16)21(28)25-17-11-15(8-9-18(17)27)33(30,31)26-14-7-5-6-13(23)10-14/h5-11,24,26-27H,4H2,1-3H3,(H,25,28) |
| InChIKey | GQFOCQQEDJQNII-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.95 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|