C17H19ClN2O3 — CID 30848189
methyl 5-[(2-chloro-4-methylphenyl)carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate (PubChem CID 30848189) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is methyl 5-[(2-chloro-4-methylphenyl)carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[(2-chloro-4-methylphenyl)carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 30848189 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | methyl 5-[(2-chloro-4-methylphenyl)carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCc1[nH]c(C(=O)Nc2ccc(C)cc2Cl)c(C)c1C(=O)OC |
| InChI | InChI=1S/C17H19ClN2O3/c1-5-12-14(17(22)23-4)10(3)15(19-12)16(21)20-13-7-6-9(2)8-11(13)18/h6-8,19H,5H2,1-4H3,(H,20,21) |
| InChIKey | QKCVEUCJISLJCX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |