C24H21N3O5 — CID 56506931
methyl 5-[[3-(1,3-dioxoisoindol-2-yl)phenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate (PubChem CID 56506931) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is methyl 5-[[3-(1,3-dioxoisoindol-2-yl)phenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 5-[[3-(1,3-dioxoisoindol-2-yl)phenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 56506931 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | methyl 5-[[3-(1,3-dioxoisoindol-2-yl)phenyl]carbamoyl]-2-ethyl-4-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCc1[nH]c(C(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)c(C)c1C(=O)OC |
| InChI | InChI=1S/C24H21N3O5/c1-4-18-19(24(31)32-3)13(2)20(26-18)21(28)25-14-8-7-9-15(12-14)27-22(29)16-10-5-6-11-17(16)23(27)30/h5-12,26H,4H2,1-3H3,(H,25,28) |
| InChIKey | JTKWLOUZURABOZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|