C22H15N3O6 — CID 56508343
N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-methoxy-3-nitrobenzamide (PubChem CID 56508343) has the molecular formula C22H15N3O6 and a molecular weight of 417.38 g/mol. Its IUPAC name is N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 56508343 |
| Molecular Formula | C22H15N3O6 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[3-(1,3-dioxoisoindol-2-yl)phenyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(N3C(=O)c4ccccc4C3=O)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H15N3O6/c1-31-19-10-9-13(11-18(19)25(29)30)20(26)23-14-5-4-6-15(12-14)24-21(27)16-7-2-3-8-17(16)22(24)28/h2-12H,1H3,(H,23,26) |
| InChIKey | ZBZHSBXOFMXIFY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|