C23H20ClN3O4S — CID 46589603
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 46589603) has the molecular formula C23H20ClN3O4S and a molecular weight of 469.95 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 46589603 |
| Molecular Formula | C23H20ClN3O4S |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)Nc1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1O |
| InChI | InChI=1S/C23H20ClN3O4S/c1-14-19(18-7-2-3-8-20(18)25-14)13-23(29)26-21-12-17(9-10-22(21)28)32(30,31)27-16-6-4-5-15(24)11-16/h2-12,25,27-28H,13H2,1H3,(H,26,29) |
| InChIKey | QBGHBSKUTFKRPE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|