C20H21ClN4O4S — CID 36928944
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide (PubChem CID 36928944) has the molecular formula C20H21ClN4O4S and a molecular weight of 448.93 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 36928944 |
| Molecular Formula | C20H21ClN4O4S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-2-(1,3,5-trimethylpyrazol-4-yl)acetamide |
| SMILES | Cc1nn(C)c(C)c1CC(=O)Nc1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1O |
| InChI | InChI=1S/C20H21ClN4O4S/c1-12-17(13(2)25(3)23-12)11-20(27)22-18-10-16(7-8-19(18)26)30(28,29)24-15-6-4-5-14(21)9-15/h4-10,24,26H,11H2,1-3H3,(H,22,27) |
| InChIKey | POLUIUAIXVQVAR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|