C20H18ClN3O6S — CID 36925060
N-[3-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyanilino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 36925060) has the molecular formula C20H18ClN3O6S and a molecular weight of 463.90 g/mol. Its IUPAC name is N-[3-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyanilino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyanilino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 36925060 |
| Molecular Formula | C20H18ClN3O6S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | N-[3-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyanilino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccco1)Nc1cc(S(=O)(=O)Nc2cccc(Cl)c2)ccc1O |
| InChI | InChI=1S/C20H18ClN3O6S/c21-13-3-1-4-14(11-13)24-31(28,29)15-6-7-17(25)16(12-15)23-19(26)8-9-22-20(27)18-5-2-10-30-18/h1-7,10-12,24-25H,8-9H2,(H,22,27)(H,23,26) |
| InChIKey | MQQXETAWXQSBGF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|