C19H26N4O4S — CID 55474079
N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 55474079) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 55474079 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-3-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)Nc1cc(S(=O)(=O)N2CCCC2)ccc1O |
| InChI | InChI=1S/C19H26N4O4S/c1-13-16(14(2)22(3)21-13)7-9-19(25)20-17-12-15(6-8-18(17)24)28(26,27)23-10-4-5-11-23/h6,8,12,24H,4-5,7,9-11H2,1-3H3,(H,20,25) |
| InChIKey | ATYOPXWADODLLQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|