C24H22ClN3O5S — CID 46430900
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-[(2-methylcyclopropanecarbonyl)amino]benzamide (PubChem CID 46430900) has the molecular formula C24H22ClN3O5S and a molecular weight of 499.98 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-[(2-methylcyclopropanecarbonyl)amino]benzamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-[(2-methylcyclopropanecarbonyl)amino]benzamide |
|---|---|
| PubChem CID | 46430900 |
| Molecular Formula | C24H22ClN3O5S |
| Molecular Weight | 499.98 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-4-[(2-methylcyclopropanecarbonyl)amino]benzamide |
| SMILES | CC1CC1C(=O)Nc1ccc(C(=O)Nc2cc(S(=O)(=O)Nc3cccc(Cl)c3)ccc2O)cc1 |
| InChI | InChI=1S/C24H22ClN3O5S/c1-14-11-20(14)24(31)26-17-7-5-15(6-8-17)23(30)27-21-13-19(9-10-22(21)29)34(32,33)28-18-4-2-3-16(25)12-18/h2-10,12-14,20,28-29H,11H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | MLCUCTSKEKAIST-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.98 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|