C22H26ClN3O5S — CID 43066572
N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(2-methylpropanoyl)piperidine-3-carboxamide (PubChem CID 43066572) has the molecular formula C22H26ClN3O5S and a molecular weight of 479.99 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(2-methylpropanoyl)piperidine-3-carboxamide.
| Compound Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(2-methylpropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43066572 |
| Molecular Formula | C22H26ClN3O5S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | N-[5-[(3-chlorophenyl)sulfamoyl]-2-hydroxyphenyl]-1-(2-methylpropanoyl)piperidine-3-carboxamide |
| SMILES | CC(C)C(=O)N1CCCC(C(=O)Nc2cc(S(=O)(=O)Nc3cccc(Cl)c3)ccc2O)C1 |
| InChI | InChI=1S/C22H26ClN3O5S/c1-14(2)22(29)26-10-4-5-15(13-26)21(28)24-19-12-18(8-9-20(19)27)32(30,31)25-17-7-3-6-16(23)11-17/h3,6-9,11-12,14-15,25,27H,4-5,10,13H2,1-2H3,(H,24,28) |
| InChIKey | HYLWARQCADIXDQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|