C16H19Cl3N2O2 — CID 47026261
1-(2-methylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide (PubChem CID 47026261) has the molecular formula C16H19Cl3N2O2 and a molecular weight of 377.70 g/mol. Its IUPAC name is 1-(2-methylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(2-methylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 47026261 |
| Molecular Formula | C16H19Cl3N2O2 |
| Molecular Weight | 377.70 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 1-(2-methylpropanoyl)-N-(2,4,5-trichlorophenyl)piperidine-3-carboxamide |
| SMILES | CC(C)C(=O)N1CCCC(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H19Cl3N2O2/c1-9(2)16(23)21-5-3-4-10(8-21)15(22)20-14-7-12(18)11(17)6-13(14)19/h6-7,9-10H,3-5,8H2,1-2H3,(H,20,22) |
| InChIKey | CNZQDSJYYNXELR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|