C16H21Cl2N3O2 — CID 51941064
(3S)-3-N-(3,4-dichlorophenyl)-1-N-propan-2-ylpiperidine-1,3-dicarboxamide (PubChem CID 51941064) has the molecular formula C16H21Cl2N3O2 and a molecular weight of 358.27 g/mol. Its IUPAC name is (3S)-3-N-(3,4-dichlorophenyl)-1-N-propan-2-ylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(3,4-dichlorophenyl)-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51941064 |
| Molecular Formula | C16H21Cl2N3O2 |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | (3S)-3-N-(3,4-dichlorophenyl)-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
| SMILES | CC(C)NC(=O)N1CCC[C@H](C(=O)Nc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H21Cl2N3O2/c1-10(2)19-16(23)21-7-3-4-11(9-21)15(22)20-12-5-6-13(17)14(18)8-12/h5-6,8,10-11H,3-4,7,9H2,1-2H3,(H,19,23)(H,20,22)/t11-/m0/s1 |
| InChIKey | QZVVVVFPUANOTI-NSHDSACASA-N |
| XLogP | 3.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |