C16H23N3O2 — CID 42928143
3-N-phenyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide (PubChem CID 42928143) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-N-phenyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-phenyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 42928143 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 3-N-phenyl-1-N-propan-2-ylpiperidine-1,3-dicarboxamide |
| SMILES | CC(C)NC(=O)N1CCCC(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C16H23N3O2/c1-12(2)17-16(21)19-10-6-7-13(11-19)15(20)18-14-8-4-3-5-9-14/h3-5,8-9,12-13H,6-7,10-11H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | BSXXOKXHXSTNHA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |