C20H22N4O3 — CID 51928183
(3R)-1-(benzamidocarbamoyl)-N-phenylpiperidine-3-carboxamide (PubChem CID 51928183) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is (3R)-1-(benzamidocarbamoyl)-N-phenylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-(benzamidocarbamoyl)-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51928183 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (3R)-1-(benzamidocarbamoyl)-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(NNC(=O)N1CCC[C@@H](C(=O)Nc2ccccc2)C1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O3/c25-18(21-17-11-5-2-6-12-17)16-10-7-13-24(14-16)20(27)23-22-19(26)15-8-3-1-4-9-15/h1-6,8-9,11-12,16H,7,10,13-14H2,(H,21,25)(H,22,26)(H,23,27)/t16-/m1/s1 |
| InChIKey | JAIDPIGJYGREFF-MRXNPFEDSA-N |
| XLogP | 2.39 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|