C27H28N4O4 — CID 41036902
(3R)-3-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 41036902) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is (3R)-3-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 41036902 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | (3R)-3-N-[4-[(4-methoxyphenyl)carbamoyl]phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc(NC(=O)[C@@H]3CCCN(C(=O)Nc4ccccc4)C3)cc2)cc1 |
| InChI | InChI=1S/C27H28N4O4/c1-35-24-15-13-23(14-16-24)28-25(32)19-9-11-22(12-10-19)29-26(33)20-6-5-17-31(18-20)27(34)30-21-7-3-2-4-8-21/h2-4,7-16,20H,5-6,17-18H2,1H3,(H,28,32)(H,29,33)(H,30,34)/t20-/m1/s1 |
| InChIKey | DDDNNHWWXCVTQK-HXUWFJFHSA-N |
| XLogP | 4.83 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |