C19H20FN3O2 — CID 9070375
(3S)-3-N-(4-fluorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 9070375) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is (3S)-3-N-(4-fluorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(4-fluorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 9070375 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (3S)-3-N-(4-fluorophenyl)-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)[C@H]1CCCN(C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C19H20FN3O2/c20-15-8-10-17(11-9-15)21-18(24)14-5-4-12-23(13-14)19(25)22-16-6-2-1-3-7-16/h1-3,6-11,14H,4-5,12-13H2,(H,21,24)(H,22,25)/t14-/m0/s1 |
| InChIKey | WFINIKBDKQKFMW-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |