C21H24FN3O2 — CID 51686700
(3R)-3-N-(2-ethylphenyl)-1-N-(4-fluorophenyl)piperidine-1,3-dicarboxamide (PubChem CID 51686700) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is (3R)-3-N-(2-ethylphenyl)-1-N-(4-fluorophenyl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-(2-ethylphenyl)-1-N-(4-fluorophenyl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 51686700 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (3R)-3-N-(2-ethylphenyl)-1-N-(4-fluorophenyl)piperidine-1,3-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)[C@@H]1CCCN(C(=O)Nc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C21H24FN3O2/c1-2-15-6-3-4-8-19(15)24-20(26)16-7-5-13-25(14-16)21(27)23-18-11-9-17(22)10-12-18/h3-4,6,8-12,16H,2,5,7,13-14H2,1H3,(H,23,27)(H,24,26)/t16-/m1/s1 |
| InChIKey | DGCVAXIAXLGJAN-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |