C23H26N4O3 — CID 55489108
3-N-[4-(cyclopropylcarbamoyl)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide (PubChem CID 55489108) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-N-[4-(cyclopropylcarbamoyl)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-[4-(cyclopropylcarbamoyl)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 55489108 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 3-N-[4-(cyclopropylcarbamoyl)phenyl]-1-N-phenylpiperidine-1,3-dicarboxamide |
| SMILES | O=C(NC1CC1)c1ccc(NC(=O)C2CCCN(C(=O)Nc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C23H26N4O3/c28-21(24-20-12-13-20)16-8-10-19(11-9-16)25-22(29)17-5-4-14-27(15-17)23(30)26-18-6-2-1-3-7-18/h1-3,6-11,17,20H,4-5,12-15H2,(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | XSFSQFVALQKAPV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |