C17H16Cl2N2O2S — CID 42946658
N-(3,4-dichlorophenyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 42946658) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42946658 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)C1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C17H16Cl2N2O2S/c18-13-6-5-12(9-14(13)19)20-16(22)11-3-1-7-21(10-11)17(23)15-4-2-8-24-15/h2,4-6,8-9,11H,1,3,7,10H2,(H,20,22) |
| InChIKey | ANBGOIHEMLIOQV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |