C20H18ClN3O2S — CID 25337021
(3R)-N-(8-chloroquinolin-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 25337021) has the molecular formula C20H18ClN3O2S and a molecular weight of 399.90 g/mol. Its IUPAC name is (3R)-N-(8-chloroquinolin-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(8-chloroquinolin-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 25337021 |
| Molecular Formula | C20H18ClN3O2S |
| Molecular Weight | 399.90 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (3R)-N-(8-chloroquinolin-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c2ncccc12)[C@@H]1CCCN(C(=O)c2cccs2)C1 |
| InChI | InChI=1S/C20H18ClN3O2S/c21-15-7-8-16(14-5-1-9-22-18(14)15)23-19(25)13-4-2-10-24(12-13)20(26)17-6-3-11-27-17/h1,3,5-9,11,13H,2,4,10,12H2,(H,23,25)/t13-/m1/s1 |
| InChIKey | JCJKKKFHPCHECP-CYBMUJFWSA-N |
| XLogP | 4.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.90 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |