C14H17ClFN3O2 — CID 166027295
(3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-methylpiperidine-1,3-dicarboxamide (PubChem CID 166027295) has the molecular formula C14H17ClFN3O2 and a molecular weight of 313.76 g/mol. Its IUPAC name is (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 166027295 |
| Molecular Formula | C14H17ClFN3O2 |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-methylpiperidine-1,3-dicarboxamide |
| SMILES | CNC(=O)N1CCC[C@H](C(=O)Nc2ccc(Cl)c(F)c2)C1 |
| InChI | InChI=1S/C14H17ClFN3O2/c1-17-14(21)19-6-2-3-9(8-19)13(20)18-10-4-5-11(15)12(16)7-10/h4-5,7,9H,2-3,6,8H2,1H3,(H,17,21)(H,18,20)/t9-/m0/s1 |
| InChIKey | DPZJIZLWZKMIDE-VIFPVBQESA-N |
| XLogP | 2.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |