C15H17ClFN2NiO3- — CID 153400255
ethyl (3S)-3-[(4-chloro-3-fluorophenyl)carbamoyl]piperidine-1-carboxylate;nickel (PubChem CID 153400255) has the molecular formula C15H17ClFN2NiO3- and a molecular weight of 386.46 g/mol. Its IUPAC name is ethyl (3S)-3-[(4-chloro-3-fluorophenyl)carbamoyl]piperidine-1-carboxylate;nickel.
| Compound Name | ethyl (3S)-3-[(4-chloro-3-fluorophenyl)carbamoyl]piperidine-1-carboxylate;nickel |
|---|---|
| PubChem CID | 153400255 |
| Molecular Formula | C15H17ClFN2NiO3- |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | ethyl (3S)-3-[(4-chloro-3-fluorophenyl)carbamoyl]piperidine-1-carboxylate;nickel |
| SMILES | [CH2-]COC(=O)N1CCC[C@H](C(=O)Nc2ccc(Cl)c(F)c2)C1.[Ni] |
| InChI | InChI=1S/C15H17ClFN2O3.Ni/c1-2-22-15(21)19-7-3-4-10(9-19)14(20)18-11-5-6-12(16)13(17)8-11;/h5-6,8,10H,1-4,7,9H2,(H,18,20);/q-1;/t10-;/m0./s1 |
| InChIKey | KOKTYYILYXUBLU-PPHPATTJSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|