C15H16F4N2O3 — CID 146337052
methyl 3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 146337052) has the molecular formula C15H16F4N2O3 and a molecular weight of 348.30 g/mol. Its IUPAC name is methyl 3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | methyl 3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146337052 |
| Molecular Formula | C15H16F4N2O3 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | methyl 3-[[3-fluoro-4-(trifluoromethyl)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCCC(C(=O)Nc2ccc(C(F)(F)F)c(F)c2)C1 |
| InChI | InChI=1S/C15H16F4N2O3/c1-24-14(23)21-6-2-3-9(8-21)13(22)20-10-4-5-11(12(16)7-10)15(17,18)19/h4-5,7,9H,2-3,6,8H2,1H3,(H,20,22) |
| InChIKey | SMBRLYBNURWIJR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |