C15H18ClFN3NiO2- — CID 153400238
(3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-ethylpiperidine-1,3-dicarboxamide;nickel (PubChem CID 153400238) has the molecular formula C15H18ClFN3NiO2- and a molecular weight of 385.47 g/mol. Its IUPAC name is (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-ethylpiperidine-1,3-dicarboxamide;nickel.
| Compound Name | (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-ethylpiperidine-1,3-dicarboxamide;nickel |
|---|---|
| PubChem CID | 153400238 |
| Molecular Formula | C15H18ClFN3NiO2- |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | (3S)-3-N-(4-chloro-3-fluorophenyl)-1-N-ethylpiperidine-1,3-dicarboxamide;nickel |
| SMILES | [CH2-]CNC(=O)N1CCC[C@H](C(=O)Nc2ccc(Cl)c(F)c2)C1.[Ni] |
| InChI | InChI=1S/C15H18ClFN3O2.Ni/c1-2-18-15(22)20-7-3-4-10(9-20)14(21)19-11-5-6-12(16)13(17)8-11;/h5-6,8,10H,1-4,7,9H2,(H,18,22)(H,19,21);/q-1;/t10-;/m0./s1 |
| InChIKey | DLYAXVIRZAJKDB-PPHPATTJSA-N |
| XLogP | 2.67 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|