C20H29ClFN7O2 — CID 172908702
(3S)-N-(4-chloro-3-fluorophenyl)-1-[4-[2-(diaminomethylideneamino)ethyl]piperazine-1-carbonyl]piperidine-3-carboxamide (PubChem CID 172908702) has the molecular formula C20H29ClFN7O2 and a molecular weight of 453.95 g/mol. Its IUPAC name is (3S)-N-(4-chloro-3-fluorophenyl)-1-[4-[2-(diaminomethylideneamino)ethyl]piperazine-1-carbonyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-chloro-3-fluorophenyl)-1-[4-[2-(diaminomethylideneamino)ethyl]piperazine-1-carbonyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 172908702 |
| Molecular Formula | C20H29ClFN7O2 |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (3S)-N-(4-chloro-3-fluorophenyl)-1-[4-[2-(diaminomethylideneamino)ethyl]piperazine-1-carbonyl]piperidine-3-carboxamide |
| SMILES | NC(N)=NCCN1CCN(C(=O)N2CCC[C@H](C(=O)Nc3ccc(Cl)c(F)c3)C2)CC1 |
| InChI | InChI=1S/C20H29ClFN7O2/c21-16-4-3-15(12-17(16)22)26-18(30)14-2-1-6-29(13-14)20(31)28-10-8-27(9-11-28)7-5-25-19(23)24/h3-4,12,14H,1-2,5-11,13H2,(H,26,30)(H4,23,24,25)/t14-/m0/s1 |
| InChIKey | FUFZIHQUAXSDER-AWEZNQCLSA-N |
| XLogP | 1.14 |
| TPSA | 120.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|