C18H21Cl3N2O4 — CID 55994853
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 1-propanoylpiperidine-3-carboxylate (PubChem CID 55994853) has the molecular formula C18H21Cl3N2O4 and a molecular weight of 435.74 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 1-propanoylpiperidine-3-carboxylate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 1-propanoylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 55994853 |
| Molecular Formula | C18H21Cl3N2O4 |
| Molecular Weight | 435.74 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 1-propanoylpiperidine-3-carboxylate |
| SMILES | CCC(=O)N1CCCC(C(=O)OC(C)C(=O)Nc2cc(Cl)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C18H21Cl3N2O4/c1-3-16(24)23-6-4-5-11(9-23)18(26)27-10(2)17(25)22-15-8-13(20)12(19)7-14(15)21/h7-8,10-11H,3-6,9H2,1-2H3,(H,22,25) |
| InChIKey | FHQRFOROMWQSSH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|