C20H17Cl3N2O4 — CID 46792748
[1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 4-(cyclopropanecarbonylamino)benzoate (PubChem CID 46792748) has the molecular formula C20H17Cl3N2O4 and a molecular weight of 455.73 g/mol. Its IUPAC name is [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 4-(cyclopropanecarbonylamino)benzoate.
| Compound Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 4-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 46792748 |
| Molecular Formula | C20H17Cl3N2O4 |
| Molecular Weight | 455.73 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | [1-oxo-1-(2,4,5-trichloroanilino)propan-2-yl] 4-(cyclopropanecarbonylamino)benzoate |
| SMILES | CC(OC(=O)c1ccc(NC(=O)C2CC2)cc1)C(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl3N2O4/c1-10(18(26)25-17-9-15(22)14(21)8-16(17)23)29-20(28)12-4-6-13(7-5-12)24-19(27)11-2-3-11/h4-11H,2-3H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | ZWAKGRSCDQBNRE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.73 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|