C25H20ClN3O6 — CID 46792749
[2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate (PubChem CID 46792749) has the molecular formula C25H20ClN3O6 and a molecular weight of 493.90 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 46792749 |
| Molecular Formula | C25H20ClN3O6 |
| Molecular Weight | 493.90 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 4-(cyclopropanecarbonylamino)benzoate |
| SMILES | O=C(OC(C(=O)Nc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C25H20ClN3O6/c26-20-14-19(29(33)34)12-13-21(20)28-24(31)22(15-4-2-1-3-5-15)35-25(32)17-8-10-18(11-9-17)27-23(30)16-6-7-16/h1-5,8-14,16,22H,6-7H2,(H,27,30)(H,28,31) |
| InChIKey | SYNZKLFERZGNOP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|