C27H22ClN3O5 — CID 42524006
[(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate (PubChem CID 42524006) has the molecular formula C27H22ClN3O5 and a molecular weight of 503.94 g/mol. Its IUPAC name is [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 42524006 |
| Molecular Formula | C27H22ClN3O5 |
| Molecular Weight | 503.94 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | [(1S)-2-(2-chloro-4-nitroanilino)-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)O[C@H](C(=O)Nc2ccc([N+](=O)[O-])cc2Cl)c2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H22ClN3O5/c1-17-15-22(18(2)30(17)20-11-7-4-8-12-20)27(33)36-25(19-9-5-3-6-10-19)26(32)29-24-14-13-21(31(34)35)16-23(24)28/h3-16,25H,1-2H3,(H,29,32)/t25-/m0/s1 |
| InChIKey | CTIZMCLKSUOZCK-VWLOTQADSA-N |
| XLogP | 6.19 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.94 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|