C28H22ClF3N2O3 — CID 4592267
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate (PubChem CID 4592267) has the molecular formula C28H22ClF3N2O3 and a molecular weight of 526.94 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4592267 |
| Molecular Formula | C28H22ClF3N2O3 |
| Molecular Weight | 526.94 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 2,5-dimethyl-1-phenylpyrrole-3-carboxylate |
| SMILES | Cc1cc(C(=O)OC(C(=O)Nc2ccc(Cl)cc2C(F)(F)F)c2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C28H22ClF3N2O3/c1-17-15-22(18(2)34(17)21-11-7-4-8-12-21)27(36)37-25(19-9-5-3-6-10-19)26(35)33-24-14-13-20(29)16-23(24)28(30,31)32/h3-16,25H,1-2H3,(H,33,35) |
| InChIKey | HPIDWUQVMFCPFI-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.94 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|