C20H12ClF3N2O6 — CID 3933054
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate (PubChem CID 3933054) has the molecular formula C20H12ClF3N2O6 and a molecular weight of 468.77 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 3933054 |
| Molecular Formula | C20H12ClF3N2O6 |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate |
| SMILES | O=C(OC(C(=O)Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C20H12ClF3N2O6/c21-12-6-7-14(13(10-12)20(22,23)24)25-18(27)17(11-4-2-1-3-5-11)32-19(28)15-8-9-16(31-15)26(29)30/h1-10,17H,(H,25,27) |
| InChIKey | MLKCIRSPFTXWHJ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|