C20H15ClN2O7 — CID 2411199
[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate (PubChem CID 2411199) has the molecular formula C20H15ClN2O7 and a molecular weight of 430.80 g/mol. Its IUPAC name is [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 2411199 |
| Molecular Formula | C20H15ClN2O7 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 5-nitrofuran-2-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@H](OC(=O)c2ccc([N+](=O)[O-])o2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H15ClN2O7/c1-28-15-8-7-13(11-14(15)21)22-19(24)18(12-5-3-2-4-6-12)30-20(25)16-9-10-17(29-16)23(26)27/h2-11,18H,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | AUMDXFYDFZZDDG-GOSISDBHSA-N |
| XLogP | 4.39 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|