C16H16N2O8 — CID 55417910
[1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 55417910) has the molecular formula C16H16N2O8 and a molecular weight of 364.31 g/mol. Its IUPAC name is [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 55417910 |
| Molecular Formula | C16H16N2O8 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)c2ccc([N+](=O)[O-])o2)cc1OC |
| InChI | InChI=1S/C16H16N2O8/c1-9(25-16(20)12-6-7-14(26-12)18(21)22)15(19)17-10-4-5-11(23-2)13(8-10)24-3/h4-9H,1-3H3,(H,17,19) |
| InChIKey | GGFSIYNFBUEFPY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 130.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|