C15H14N2O7 — CID 9454906
[(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate (PubChem CID 9454906) has the molecular formula C15H14N2O7 and a molecular weight of 334.28 g/mol. Its IUPAC name is [(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate.
| Compound Name | [(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
|---|---|
| PubChem CID | 9454906 |
| Molecular Formula | C15H14N2O7 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [(2R)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 5-nitrofuran-2-carboxylate |
| SMILES | COc1cccc(NC(=O)[C@@H](C)OC(=O)c2ccc([N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C15H14N2O7/c1-9(14(18)16-10-4-3-5-11(8-10)22-2)23-15(19)12-6-7-13(24-12)17(20)21/h3-9H,1-2H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | OWUBUSKTOQYAJS-SECBINFHSA-N |
| XLogP | 2.38 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|