C18H17ClN2O7 — CID 55512261
[1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate (PubChem CID 55512261) has the molecular formula C18H17ClN2O7 and a molecular weight of 408.79 g/mol. Its IUPAC name is [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate.
| Compound Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate |
|---|---|
| PubChem CID | 55512261 |
| Molecular Formula | C18H17ClN2O7 |
| Molecular Weight | 408.79 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | [1-(3,4-dimethoxyanilino)-1-oxopropan-2-yl] 4-chloro-2-nitrobenzoate |
| SMILES | COc1ccc(NC(=O)C(C)OC(=O)c2ccc(Cl)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H17ClN2O7/c1-10(17(22)20-12-5-7-15(26-2)16(9-12)27-3)28-18(23)13-6-4-11(19)8-14(13)21(24)25/h4-10H,1-3H3,(H,20,22) |
| InChIKey | JRCHPEHCTGLUEX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.79 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|