C21H17ClN2O5 — CID 7774236
[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 7774236) has the molecular formula C21H17ClN2O5 and a molecular weight of 412.83 g/mol. Its IUPAC name is [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 7774236 |
| Molecular Formula | C21H17ClN2O5 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@H](OC(=O)c2cccc[n+]2[O-])c2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H17ClN2O5/c1-28-18-11-10-15(13-16(18)22)23-20(25)19(14-7-3-2-4-8-14)29-21(26)17-9-5-6-12-24(17)27/h2-13,19H,1H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | DCAFMHJQJJYYJH-LJQANCHMSA-N |
| XLogP | 3.52 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|