C25H18ClNO6 — CID 2417094
[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 4-oxochromene-2-carboxylate (PubChem CID 2417094) has the molecular formula C25H18ClNO6 and a molecular weight of 463.87 g/mol. Its IUPAC name is [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 2417094 |
| Molecular Formula | C25H18ClNO6 |
| Molecular Weight | 463.87 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 4-oxochromene-2-carboxylate |
| SMILES | COc1ccc(NC(=O)[C@H](OC(=O)c2cc(=O)c3ccccc3o2)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H18ClNO6/c1-31-21-12-11-16(13-18(21)26)27-24(29)23(15-7-3-2-4-8-15)33-25(30)22-14-19(28)17-9-5-6-10-20(17)32-22/h2-14,23H,1H3,(H,27,29)/t23-/m1/s1 |
| InChIKey | CPZBQNYNCUHMIP-HSZRJFAPSA-N |
| XLogP | 4.99 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.87 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |