C23H21ClN2O5 — CID 2396231
[(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 2-ethoxypyridine-3-carboxylate (PubChem CID 2396231) has the molecular formula C23H21ClN2O5 and a molecular weight of 440.88 g/mol. Its IUPAC name is [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 2-ethoxypyridine-3-carboxylate.
| Compound Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 2-ethoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 2396231 |
| Molecular Formula | C23H21ClN2O5 |
| Molecular Weight | 440.88 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | [(1R)-2-(3-chloro-4-methoxyanilino)-2-oxo-1-phenylethyl] 2-ethoxypyridine-3-carboxylate |
| SMILES | CCOc1ncccc1C(=O)O[C@@H](C(=O)Nc1ccc(OC)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C23H21ClN2O5/c1-3-30-22-17(10-7-13-25-22)23(28)31-20(15-8-5-4-6-9-15)21(27)26-16-11-12-19(29-2)18(24)14-16/h4-14,20H,3H2,1-2H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | XEJNMIJGFMOBEN-HXUWFJFHSA-N |
| XLogP | 4.68 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.88 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |