C20H13ClF3NO4 — CID 2358430
[(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] furan-2-carboxylate (PubChem CID 2358430) has the molecular formula C20H13ClF3NO4 and a molecular weight of 423.77 g/mol. Its IUPAC name is [(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] furan-2-carboxylate.
| Compound Name | [(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 2358430 |
| Molecular Formula | C20H13ClF3NO4 |
| Molecular Weight | 423.77 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | [(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl] furan-2-carboxylate |
| SMILES | O=C(O[C@@H](C(=O)Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C20H13ClF3NO4/c21-13-8-9-15(14(11-13)20(22,23)24)25-18(26)17(12-5-2-1-3-6-12)29-19(27)16-7-4-10-28-16/h1-11,17H,(H,25,26)/t17-/m1/s1 |
| InChIKey | CVCYCUVXRAPPET-QGZVFWFLSA-N |
| XLogP | 5.49 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.77 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |