C20H16ClF3N2O2 — CID 4842465
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(furan-2-ylmethylamino)-2-phenylacetamide (PubChem CID 4842465) has the molecular formula C20H16ClF3N2O2 and a molecular weight of 408.81 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(furan-2-ylmethylamino)-2-phenylacetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(furan-2-ylmethylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 4842465 |
| Molecular Formula | C20H16ClF3N2O2 |
| Molecular Weight | 408.81 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(furan-2-ylmethylamino)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)C(NCc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C20H16ClF3N2O2/c21-14-8-9-17(16(11-14)20(22,23)24)26-19(27)18(13-5-2-1-3-6-13)25-12-15-7-4-10-28-15/h1-11,18,25H,12H2,(H,26,27) |
| InChIKey | AXUDJJORLXCAQP-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.81 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |