C23H26ClF3N2O — CID 2440712
(2R)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclooctylamino)-2-phenylacetamide (PubChem CID 2440712) has the molecular formula C23H26ClF3N2O and a molecular weight of 438.92 g/mol. Its IUPAC name is (2R)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclooctylamino)-2-phenylacetamide.
| Compound Name | (2R)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclooctylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 2440712 |
| Molecular Formula | C23H26ClF3N2O |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (2R)-N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclooctylamino)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)[C@H](NC1CCCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H26ClF3N2O/c24-17-13-14-20(19(15-17)23(25,26)27)29-22(30)21(16-9-5-4-6-10-16)28-18-11-7-2-1-3-8-12-18/h4-6,9-10,13-15,18,21,28H,1-3,7-8,11-12H2,(H,29,30)/t21-/m1/s1 |
| InChIKey | GUCFCNIKKNULPZ-OAQYLSRUSA-N |
| XLogP | 6.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |