C23H27ClF3N2O+ — CID 2440711
[(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl]-cyclooctylazanium (PubChem CID 2440711) has the molecular formula C23H27ClF3N2O+ and a molecular weight of 439.93 g/mol. Its IUPAC name is [(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl]-cyclooctylazanium.
| Compound Name | [(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl]-cyclooctylazanium |
|---|---|
| PubChem CID | 2440711 |
| Molecular Formula | C23H27ClF3N2O+ |
| Molecular Weight | 439.93 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [(1R)-2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxo-1-phenylethyl]-cyclooctylazanium |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)[C@H]([NH2+]C1CCCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H26ClF3N2O/c24-17-13-14-20(19(15-17)23(25,26)27)29-22(30)21(16-9-5-4-6-10-16)28-18-11-7-2-1-3-8-12-18/h4-6,9-10,13-15,18,21,28H,1-3,7-8,11-12H2,(H,29,30)/p+1/t21-/m1/s1 |
| InChIKey | GUCFCNIKKNULPZ-OAQYLSRUSA-O |
| XLogP | 5.71 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.93 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |