C17H25ClFN2O+ — CID 9444244
[(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl]-cyclooctylazanium (PubChem CID 9444244) has the molecular formula C17H25ClFN2O+ and a molecular weight of 327.85 g/mol. Its IUPAC name is [(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl]-cyclooctylazanium.
| Compound Name | [(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl]-cyclooctylazanium |
|---|---|
| PubChem CID | 9444244 |
| Molecular Formula | C17H25ClFN2O+ |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | [(2R)-1-(4-chloro-2-fluoroanilino)-1-oxopropan-2-yl]-cyclooctylazanium |
| SMILES | C[C@@H]([NH2+]C1CCCCCCC1)C(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C17H24ClFN2O/c1-12(20-14-7-5-3-2-4-6-8-14)17(22)21-16-10-9-13(18)11-15(16)19/h9-12,14,20H,2-8H2,1H3,(H,21,22)/p+1/t12-/m1/s1 |
| InChIKey | GYPDSBYYYOAWKG-GFCCVEGCSA-O |
| XLogP | 3.48 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |