C15H22ClN2O+ — CID 7928366
[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-cyclohexylazanium (PubChem CID 7928366) has the molecular formula C15H22ClN2O+ and a molecular weight of 281.81 g/mol. Its IUPAC name is [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-cyclohexylazanium.
| Compound Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-cyclohexylazanium |
|---|---|
| PubChem CID | 7928366 |
| Molecular Formula | C15H22ClN2O+ |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-cyclohexylazanium |
| SMILES | C[C@@H]([NH2+]C1CCCCC1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O/c1-11(17-13-7-3-2-4-8-13)15(19)18-14-9-5-6-12(16)10-14/h5-6,9-11,13,17H,2-4,7-8H2,1H3,(H,18,19)/p+1/t11-/m1/s1 |
| InChIKey | WSIRNPUWMQRVEJ-LLVKDONJSA-O |
| XLogP | 2.56 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |