C19H26ClN2O+ — CID 9358471
1-adamantyl-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]azanium (PubChem CID 9358471) has the molecular formula C19H26ClN2O+ and a molecular weight of 333.88 g/mol. Its IUPAC name is 1-adamantyl-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | 1-adamantyl-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9358471 |
| Molecular Formula | C19H26ClN2O+ |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-adamantyl-[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]azanium |
| SMILES | C[C@@H]([NH2+]C12CC3CC(CC(C3)C1)C2)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H25ClN2O/c1-12(18(23)21-17-4-2-3-16(20)8-17)22-19-9-13-5-14(10-19)7-15(6-13)11-19/h2-4,8,12-15,22H,5-7,9-11H2,1H3,(H,21,23)/p+1/t12-,13?,14?,15?,19?/m1/s1 |
| InChIKey | KDZLUQVJTZSJOY-XUXNNNHQSA-O |
| XLogP | 3.20 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |