C12H18ClN2O+ — CID 2412456
[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-propylazanium (PubChem CID 2412456) has the molecular formula C12H18ClN2O+ and a molecular weight of 241.74 g/mol. Its IUPAC name is [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-propylazanium.
| Compound Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-propylazanium |
|---|---|
| PubChem CID | 2412456 |
| Molecular Formula | C12H18ClN2O+ |
| Molecular Weight | 241.74 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl]-propylazanium |
| SMILES | CCC[NH2+][C@H](C)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O/c1-3-7-14-9(2)12(16)15-11-6-4-5-10(13)8-11/h4-6,8-9,14H,3,7H2,1-2H3,(H,15,16)/p+1/t9-/m1/s1 |
| InChIKey | SOCWAALQOSBVIF-SECBINFHSA-O |
| XLogP | 1.64 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |