C11H13BrClNO — CID 19256824
2-bromo-N-(3-chlorophenyl)pentanamide (PubChem CID 19256824) has the molecular formula C11H13BrClNO and a molecular weight of 290.59 g/mol. Its IUPAC name is 2-bromo-N-(3-chlorophenyl)pentanamide.
| Compound Name | 2-bromo-N-(3-chlorophenyl)pentanamide |
|---|---|
| PubChem CID | 19256824 |
| Molecular Formula | C11H13BrClNO |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-bromo-N-(3-chlorophenyl)pentanamide |
| SMILES | CCCC(Br)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13BrClNO/c1-2-4-10(12)11(15)14-9-6-3-5-8(13)7-9/h3,5-7,10H,2,4H2,1H3,(H,14,15) |
| InChIKey | HEEFPMUTOPXEII-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|