C12H16ClN3O2 — CID 76926784
N-(3-chlorophenyl)-2-(N'-hydroxycarbamimidoyl)pentanamide (PubChem CID 76926784) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(N'-hydroxycarbamimidoyl)pentanamide.
| Compound Name | N-(3-chlorophenyl)-2-(N'-hydroxycarbamimidoyl)pentanamide |
|---|---|
| PubChem CID | 76926784 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-(N'-hydroxycarbamimidoyl)pentanamide |
| SMILES | CCCC(C(=O)Nc1cccc(Cl)c1)C(N)=NO |
| InChI | InChI=1S/C12H16ClN3O2/c1-2-4-10(11(14)16-18)12(17)15-9-6-3-5-8(13)7-9/h3,5-7,10,18H,2,4H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | LLHSNYMUSOJENX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|