C10H14ClN3O — CID 77026492
2-(3-chloroanilino)-N'-hydroxybutanimidamide (PubChem CID 77026492) has the molecular formula C10H14ClN3O and a molecular weight of 227.70 g/mol. Its IUPAC name is 2-(3-chloroanilino)-N'-hydroxybutanimidamide.
| Compound Name | 2-(3-chloroanilino)-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 77026492 |
| Molecular Formula | C10H14ClN3O |
| Molecular Weight | 227.70 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(3-chloroanilino)-N'-hydroxybutanimidamide |
| SMILES | CCC(Nc1cccc(Cl)c1)C(N)=NO |
| InChI | InChI=1S/C10H14ClN3O/c1-2-9(10(12)14-15)13-8-5-3-4-7(11)6-8/h3-6,9,13,15H,2H2,1H3,(H2,12,14) |
| InChIKey | HKPBXFWKTNSRSA-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|